C8H15FN2 — CID 146438311
6-fluoro-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 146438311) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is 6-fluoro-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | 6-fluoro-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 146438311 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 6-fluoro-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CCC2CCN(F)CC21 |
| InChI | InChI=1S/C8H15FN2/c1-10-4-2-7-3-5-11(9)6-8(7)10/h7-8H,2-6H2,1H3 |
| InChIKey | MHUNQIYDXIWAMB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|