C28H22N4O6 — CID 146438337
2-(2,6-dioxopiperidin-3-yl)-4-[[2-hydroxy-4-(1H-indol-4-yl)-6-oxocyclohexen-1-yl]methylideneamino]isoindole-1,3-dione (PubChem CID 146438337) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[2-hydroxy-4-(1H-indol-4-yl)-6-oxocyclohexen-1-yl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[2-hydroxy-4-(1H-indol-4-yl)-6-oxocyclohexen-1-yl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146438337 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[2-hydroxy-4-(1H-indol-4-yl)-6-oxocyclohexen-1-yl]methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(/N=C/C4=C(O)CC(c5cccc6[nH]ccc56)CC4=O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H22N4O6/c33-22-11-14(15-3-1-5-19-16(15)9-10-29-19)12-23(34)18(22)13-30-20-6-2-4-17-25(20)28(38)32(27(17)37)21-7-8-24(35)31-26(21)36/h1-6,9-10,13-14,21,29,33H,7-8,11-12H2,(H,31,35,36)/b30-13+ |
| InChIKey | IQWCLVOLQLAUME-VVEOGCPPSA-N |
| XLogP | 3.23 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|