C10H14F6N2 — CID 146439014
1-fluoro-4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperazine (PubChem CID 146439014) has the molecular formula C10H14F6N2 and a molecular weight of 276.22 g/mol. Its IUPAC name is 1-fluoro-4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperazine.
| Compound Name | 1-fluoro-4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperazine |
|---|---|
| PubChem CID | 146439014 |
| Molecular Formula | C10H14F6N2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-fluoro-4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperazine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CCN(F)CC1 |
| InChI | InChI=1S/C10H14F6N2/c1-7(2)9(12,13)8(11)10(14,15)17-3-5-18(16)6-4-17/h8H,1,3-6H2,2H3 |
| InChIKey | INOUYXLATBILRR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|