C6H6F7N — CID 146439093
(Z)-N,N,1,1,2,3,3-heptafluorohex-4-en-1-amine (PubChem CID 146439093) has the molecular formula C6H6F7N and a molecular weight of 225.11 g/mol. Its IUPAC name is (Z)-N,N,1,1,2,3,3-heptafluorohex-4-en-1-amine.
| Compound Name | (Z)-N,N,1,1,2,3,3-heptafluorohex-4-en-1-amine |
|---|---|
| PubChem CID | 146439093 |
| Molecular Formula | C6H6F7N |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (Z)-N,N,1,1,2,3,3-heptafluorohex-4-en-1-amine |
| SMILES | C/C=C\C(F)(F)C(F)C(F)(F)N(F)F |
| InChI | InChI=1S/C6H6F7N/c1-2-3-5(8,9)4(7)6(10,11)14(12)13/h2-4H,1H3/b3-2- |
| InChIKey | JRLRFIKAZRKWFM-IHWYPQMZSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|