C20H21ClF2N8O — CID 146440058
N,N'-diamino-10-chloro-9-[1-(difluoromethyl)pyrazol-4-yl]-2-oxo-6-propan-2-yl-7H-pyrido[2,1-a]phthalazine-3-carboximidamide (PubChem CID 146440058) has the molecular formula C20H21ClF2N8O and a molecular weight of 462.89 g/mol. Its IUPAC name is N,N'-diamino-10-chloro-9-[1-(difluoromethyl)pyrazol-4-yl]-2-oxo-6-propan-2-yl-7H-pyrido[2,1-a]phthalazine-3-carboximidamide.
| Compound Name | N,N'-diamino-10-chloro-9-[1-(difluoromethyl)pyrazol-4-yl]-2-oxo-6-propan-2-yl-7H-pyrido[2,1-a]phthalazine-3-carboximidamide |
|---|---|
| PubChem CID | 146440058 |
| Molecular Formula | C20H21ClF2N8O |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N,N'-diamino-10-chloro-9-[1-(difluoromethyl)pyrazol-4-yl]-2-oxo-6-propan-2-yl-7H-pyrido[2,1-a]phthalazine-3-carboximidamide |
| SMILES | CC(C)N1Cc2cc(-c3cnn(C(F)F)c3)c(Cl)cc2-c2cc(=O)c(/C(=N/N)NN)cn21 |
| InChI | InChI=1S/C20H21ClF2N8O/c1-10(2)30-8-11-3-13(12-6-26-29(7-12)20(22)23)16(21)4-14(11)17-5-18(32)15(9-31(17)30)19(27-24)28-25/h3-7,9-10,20H,8,24-25H2,1-2H3,(H,27,28) |
| InChIKey | PCUJUUMYUFFYCU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|