About N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine
N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine (PubChem CID 14644143) has the molecular formula C7H12FN
and a molecular weight of 131.19 g/mol. Its IUPAC name is N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine.
Molecular Properties
| Compound Name | N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine |
| PubChem CID | 14644143 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine |
| SMILES | [2H]C([2H])(C=C)/N=C(\C)C(C)F |
| InChI | InChI=1S/C7H12FN/c1-4-5-9-7(3)6(2)8/h4,6H,1,5H2,2-3H3/b9-7+/i5D2 |
| InChIKey | ZTLUMKAGYHMLFT-GPXZFVOZSA-N |
| XLogP | 1.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine?
The IUPAC name of N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine (CID 14644143) is N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine.
What is the SMILES notation for N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine?
The canonical SMILES for N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine is [2H]C([2H])(C=C)/N=C(\C)C(C)F.
What is the InChIKey of N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine?
The InChIKey is ZTLUMKAGYHMLFT-GPXZFVOZSA-N. The full InChI is InChI=1S/C7H12FN/c1-4-5-9-7(3)6(2)8/h4,6H,1,5H2,2-3H3/b9-7+/i5D2.
What are the key properties of N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine?
N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine has a molecular weight of 131.19 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dideuterioprop-2-enyl)-3-fluorobutan-2-imine is sourced from PubChem (CID 14644143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).