C24H29ClN4O5S — CID 146441931
N-[(4-chlorophenyl)methyl]-2-[2-(1,1-dihydroxy-1,2-thiazolidin-2-yl)ethyl]-1,6-dioxo-9-prop-2-enyl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 146441931) has the molecular formula C24H29ClN4O5S and a molecular weight of 521.04 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[2-(1,1-dihydroxy-1,2-thiazolidin-2-yl)ethyl]-1,6-dioxo-9-prop-2-enyl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[2-(1,1-dihydroxy-1,2-thiazolidin-2-yl)ethyl]-1,6-dioxo-9-prop-2-enyl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 146441931 |
| Molecular Formula | C24H29ClN4O5S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[2-(1,1-dihydroxy-1,2-thiazolidin-2-yl)ethyl]-1,6-dioxo-9-prop-2-enyl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | C=CCc1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)n2c1C(=O)N(CCN1CCCS1(O)O)CC2 |
| InChI | InChI=1S/C24H29ClN4O5S/c1-2-4-18-15-20(22(30)26-16-17-5-7-19(25)8-6-17)23(31)29-13-11-27(24(32)21(18)29)10-12-28-9-3-14-35(28,33)34/h2,5-8,15,33-34H,1,3-4,9-14,16H2,(H,26,30) |
| InChIKey | KVKQKSDOUHMPAU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|