C31H48N4O7 — CID 146442579
[4-[2-(hexanoylamino)-3-[[1-[[4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]carbamic acid (PubChem CID 146442579) has the molecular formula C31H48N4O7 and a molecular weight of 588.75 g/mol. Its IUPAC name is [4-[2-(hexanoylamino)-3-[[1-[[4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]carbamic acid.
| Compound Name | [4-[2-(hexanoylamino)-3-[[1-[[4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 146442579 |
| Molecular Formula | C31H48N4O7 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | [4-[2-(hexanoylamino)-3-[[1-[[4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]carbamic acid |
| SMILES | CCCCCC(=O)NC(Cc1ccc(NC(=O)O)cc1)C(=O)NC(CCCC)C(=O)NC(CC(C)C)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C31H48N4O7/c1-6-8-10-12-26(36)33-25(18-21-13-15-22(16-14-21)32-30(40)41)29(39)34-23(11-9-7-2)28(38)35-24(17-20(3)4)27(37)31(5)19-42-31/h13-16,20,23-25,32H,6-12,17-19H2,1-5H3,(H,33,36)(H,34,39)(H,35,38)(H,40,41)/t23?,24?,25?,31-/m1/s1 |
| InChIKey | PWXKXUDSMHUEEX-XSINHCDUSA-N |
| XLogP | 3.95 |
| TPSA | 166.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|