C21H25ClN4O2 — CID 146442614
7-[1-[4-(1-chloro-2-cyclopropylethyl)phenyl]ethylamino]-1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (PubChem CID 146442614) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 7-[1-[4-(1-chloro-2-cyclopropylethyl)phenyl]ethylamino]-1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one.
| Compound Name | 7-[1-[4-(1-chloro-2-cyclopropylethyl)phenyl]ethylamino]-1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 146442614 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 7-[1-[4-(1-chloro-2-cyclopropylethyl)phenyl]ethylamino]-1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| SMILES | CCN1C(=O)OCc2cnc(NC(C)c3ccc(C(Cl)CC4CC4)cc3)nc21 |
| InChI | InChI=1S/C21H25ClN4O2/c1-3-26-19-17(12-28-21(26)27)11-23-20(25-19)24-13(2)15-6-8-16(9-7-15)18(22)10-14-4-5-14/h6-9,11,13-14,18H,3-5,10,12H2,1-2H3,(H,23,24,25) |
| InChIKey | DYPVUPYPAAXDDO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|