C17H27N3O3 — CID 146442681
4-[1-[4-[(1S)-1-aminoethyl]phenyl]-3-methoxypropyl]piperazine-1-carboxylic acid (PubChem CID 146442681) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[1-[4-[(1S)-1-aminoethyl]phenyl]-3-methoxypropyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[1-[4-[(1S)-1-aminoethyl]phenyl]-3-methoxypropyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146442681 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 4-[1-[4-[(1S)-1-aminoethyl]phenyl]-3-methoxypropyl]piperazine-1-carboxylic acid |
| SMILES | COCCC(c1ccc([C@H](C)N)cc1)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-13(18)14-3-5-15(6-4-14)16(7-12-23-2)19-8-10-20(11-9-19)17(21)22/h3-6,13,16H,7-12,18H2,1-2H3,(H,21,22)/t13-,16?/m0/s1 |
| InChIKey | ZHZAJZZQPARDNB-KNVGNIICSA-N |
| XLogP | 2.08 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |