C20H36N2 — CID 146442827
N-dodecyl-1-phenylethane-1,2-diamine (PubChem CID 146442827) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N-dodecyl-1-phenylethane-1,2-diamine.
| Compound Name | N-dodecyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 146442827 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N-dodecyl-1-phenylethane-1,2-diamine |
| SMILES | CCCCCCCCCCCCNC(CN)c1ccccc1 |
| InChI | InChI=1S/C20H36N2/c1-2-3-4-5-6-7-8-9-10-14-17-22-20(18-21)19-15-12-11-13-16-19/h11-13,15-16,20,22H,2-10,14,17-18,21H2,1H3 |
| InChIKey | MJBWVYZMQNRRLJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|