C14H26O4S — CID 146442858
2-(1-carboxyethylsulfanyl)-2-methyldecanoic acid (PubChem CID 146442858) has the molecular formula C14H26O4S and a molecular weight of 290.42 g/mol. Its IUPAC name is 2-(1-carboxyethylsulfanyl)-2-methyldecanoic acid.
| Compound Name | 2-(1-carboxyethylsulfanyl)-2-methyldecanoic acid |
|---|---|
| PubChem CID | 146442858 |
| Molecular Formula | C14H26O4S |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-(1-carboxyethylsulfanyl)-2-methyldecanoic acid |
| SMILES | CCCCCCCCC(C)(SC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26O4S/c1-4-5-6-7-8-9-10-14(3,13(17)18)19-11(2)12(15)16/h11H,4-10H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | RQSIIXOCQPPFPN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|