C19H20FN7O2 — CID 146443041
3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-[1-(8-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]methanone (PubChem CID 146443041) has the molecular formula C19H20FN7O2 and a molecular weight of 397.41 g/mol. Its IUPAC name is 3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-[1-(8-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]methanone.
| Compound Name | 3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-[1-(8-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 146443041 |
| Molecular Formula | C19H20FN7O2 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-[1-(8-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ncc(F)c3ncnn23)CC1)N1CCOc2ccncc2C1 |
| InChI | InChI=1S/C19H20FN7O2/c20-15-10-22-19(27-17(15)23-12-24-27)25-5-2-13(3-6-25)18(28)26-7-8-29-16-1-4-21-9-14(16)11-26/h1,4,9-10,12-13H,2-3,5-8,11H2 |
| InChIKey | MXLBQVPUIFDRAK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |