About 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide
2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide (PubChem CID 14644322) has the molecular formula C5H11O3P
and a molecular weight of 150.11 g/mol. Its IUPAC name is 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide.
Molecular Properties
| Compound Name | 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| PubChem CID | 14644322 |
| Molecular Formula | C5H11O3P |
| Molecular Weight | 150.11 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| SMILES | CCP1(=O)OCCCO1 |
| InChI | InChI=1S/C5H11O3P/c1-2-9(6)7-4-3-5-8-9/h2-5H2,1H3 |
| InChIKey | HDTTYOVFSGTTFY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
The IUPAC name of 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide (CID 14644322) is 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide.
What is the SMILES notation for 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
The canonical SMILES for 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide is CCP1(=O)OCCCO1.
What is the InChIKey of 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
The InChIKey is HDTTYOVFSGTTFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O3P/c1-2-9(6)7-4-3-5-8-9/h2-5H2,1H3.
What are the key properties of 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide?
2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide has a molecular weight of 150.11 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3,2lambda5-dioxaphosphinane 2-oxide is sourced from PubChem (CID 14644322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).