About 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol
1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol (PubChem CID 146443282) has the molecular formula C22H20ClN3O2
and a molecular weight of 393.87 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol.
Molecular Properties
| Compound Name | 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol |
| PubChem CID | 146443282 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol |
| SMILES | OC(CNc1ccc(Cl)cc1)CNc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H20ClN3O2/c23-16-7-11-18(12-8-16)25-14-19(27)13-24-17-9-5-15(6-10-17)22-26-20-3-1-2-4-21(20)28-22/h1-12,19,24-25,27H,13-14H2 |
| InChIKey | BNCVDFWLDCNUAT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol?
The IUPAC name of 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol (CID 146443282) is 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol.
What is the SMILES notation for 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol?
The canonical SMILES for 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol is OC(CNc1ccc(Cl)cc1)CNc1ccc(-c2nc3ccccc3o2)cc1.
What is the InChIKey of 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol?
The InChIKey is BNCVDFWLDCNUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClN3O2/c23-16-7-11-18(12-8-16)25-14-19(27)13-24-17-9-5-15(6-10-17)22-26-20-3-1-2-4-21(20)28-22/h1-12,19,24-25,27H,13-14H2.
What are the key properties of 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol?
1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol has a molecular weight of 393.87 g/mol, XLogP of 5.03, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,3-benzoxazol-2-yl)anilino]-3-(4-chloroanilino)propan-2-ol is sourced from PubChem (CID 146443282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).