C27H23F2N3O3 — CID 146443855
3-(cyclopropylmethyl)-1-(2,3-difluoro-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 146443855) has the molecular formula C27H23F2N3O3 and a molecular weight of 475.50 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1-(2,3-difluoro-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-(cyclopropylmethyl)-1-(2,3-difluoro-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 146443855 |
| Molecular Formula | C27H23F2N3O3 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-(cyclopropylmethyl)-1-(2,3-difluoro-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N(C23c4ccccc4CC2Cc2cc(F)c(F)cc23)CN1CC1CC1 |
| InChI | InChI=1S/C27H23F2N3O3/c28-21-11-17-10-18-9-16-3-1-2-4-19(16)27(18,20(17)12-22(21)29)32-14-30(13-15-5-6-15)26(35)24-25(34)23(33)7-8-31(24)32/h1-4,7-8,11-12,15,18,34H,5-6,9-10,13-14H2 |
| InChIKey | DPINNKDSYXUOIF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |