C42H63N5O3 — CID 146444311
1-[5-[4-[2-(diethylamino)ethoxy]phenyl]-4,5-diphenylpent-4-enoxy]-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propan-2-ol (PubChem CID 146444311) has the molecular formula C42H63N5O3 and a molecular weight of 686.00 g/mol. Its IUPAC name is 1-[5-[4-[2-(diethylamino)ethoxy]phenyl]-4,5-diphenylpent-4-enoxy]-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propan-2-ol.
| Compound Name | 1-[5-[4-[2-(diethylamino)ethoxy]phenyl]-4,5-diphenylpent-4-enoxy]-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 146444311 |
| Molecular Formula | C42H63N5O3 |
| Molecular Weight | 686.00 g/mol |
| Exact Mass | 685.49 |
| IUPAC Name | 1-[5-[4-[2-(diethylamino)ethoxy]phenyl]-4,5-diphenylpent-4-enoxy]-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propan-2-ol |
| SMILES | CCN(CC)CCOc1ccc(C(=C(CCCOCC(O)CN2CCCNCCNCCCNCC2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H63N5O3/c1-3-46(4-2)31-33-50-40-21-19-38(20-22-40)42(37-16-9-6-10-17-37)41(36-14-7-5-8-15-36)18-11-32-49-35-39(48)34-47-29-13-25-44-27-26-43-23-12-24-45-28-30-47/h5-10,14-17,19-22,39,43-45,48H,3-4,11-13,18,23-35H2,1-2H3 |
| InChIKey | PBNYGOCVRYCVOL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|