About (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride
(R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride (PubChem CID 146444800) has the molecular formula C12H22ClN3
and a molecular weight of 243.78 g/mol. Its IUPAC name is (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride |
| PubChem CID | 146444800 |
| Molecular Formula | C12H22ClN3 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride |
| SMILES | Cc1cn(C)nc1[C@H](N)C1(C)CCCC1.Cl |
| InChI | InChI=1S/C12H21N3.ClH/c1-9-8-15(3)14-10(9)11(13)12(2)6-4-5-7-12;/h8,11H,4-7,13H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | LSDSAPKXRSQTMV-MERQFXBCSA-N |
| XLogP | 2.73 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride?
The IUPAC name of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride (CID 146444800) is (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride.
What is the SMILES notation for (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride?
The canonical SMILES for (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride is Cc1cn(C)nc1[C@H](N)C1(C)CCCC1.Cl.
What is the InChIKey of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride?
The InChIKey is LSDSAPKXRSQTMV-MERQFXBCSA-N. The full InChI is InChI=1S/C12H21N3.ClH/c1-9-8-15(3)14-10(9)11(13)12(2)6-4-5-7-12;/h8,11H,4-7,13H2,1-3H3;1H/t11-;/m0./s1.
What are the key properties of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride?
(R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride has a molecular weight of 243.78 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;hydrochloride is sourced from PubChem (CID 146444800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).