C26H29ClF2N6O2S — CID 146445112
3-[[4-[5-chloro-2-[[(2S,6S)-2,6-dimethylpiperazin-1-yl]methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1-(2,2-difluoroethyl)imidazolidine-2,4-dione (PubChem CID 146445112) has the molecular formula C26H29ClF2N6O2S and a molecular weight of 563.07 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-[[(2S,6S)-2,6-dimethylpiperazin-1-yl]methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1-(2,2-difluoroethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-2-[[(2S,6S)-2,6-dimethylpiperazin-1-yl]methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1-(2,2-difluoroethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146445112 |
| Molecular Formula | C26H29ClF2N6O2S |
| Molecular Weight | 563.07 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 3-[[4-[5-chloro-2-[[(2S,6S)-2,6-dimethylpiperazin-1-yl]methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1-(2,2-difluoroethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnc3cc(CN4C(=O)CN(CC(F)F)C4=O)sc23)c1CN1[C@@H](C)CNC[C@@H]1C |
| InChI | InChI=1S/C26H29ClF2N6O2S/c1-14-4-17(27)5-19(20(14)10-34-15(2)7-30-8-16(34)3)24-25-21(31-13-32-24)6-18(38-25)9-35-23(36)12-33(26(35)37)11-22(28)29/h4-6,13,15-16,22,30H,7-12H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | LIWVLKHJUXSQFH-HOTGVXAUSA-N |
| XLogP | 4.53 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.07 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|