C27H32ClN5O3S — CID 146445149
3-[[4-[5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 146445149) has the molecular formula C27H32ClN5O3S and a molecular weight of 542.11 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146445149 |
| Molecular Formula | C27H32ClN5O3S |
| Molecular Weight | 542.11 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 3-[[4-[5-chloro-2-[(6,6-dimethylmorpholin-2-yl)methyl]-3-methylphenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnc3cc(CN4C(=O)N(C)C(C)(C)C4=O)sc23)c1CC1CNCC(C)(C)O1 |
| InChI | InChI=1S/C27H32ClN5O3S/c1-15-7-16(28)8-20(19(15)9-17-11-29-13-26(2,3)36-17)22-23-21(30-14-31-22)10-18(37-23)12-33-24(34)27(4,5)32(6)25(33)35/h7-8,10,14,17,29H,9,11-13H2,1-6H3 |
| InChIKey | CZSNWKCTJLNKPI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.11 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|