C20H24N4O — CID 146446752
2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-ylbenzamide (PubChem CID 146446752) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-ylbenzamide.
| Compound Name | 2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-ylbenzamide |
|---|---|
| PubChem CID | 146446752 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-ylbenzamide |
| SMILES | CN(C)C(=O)c1cc(-c2cnc3c(c2)C2(CCCC2)CN3)ccc1N |
| InChI | InChI=1S/C20H24N4O/c1-24(2)19(25)15-9-13(5-6-17(15)21)14-10-16-18(22-11-14)23-12-20(16)7-3-4-8-20/h5-6,9-11H,3-4,7-8,12,21H2,1-2H3,(H,22,23) |
| InChIKey | DGAUFASKKMUKJE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|