About 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride
2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride (PubChem CID 146446814) has the molecular formula C7H15ClN2O2
and a molecular weight of 194.66 g/mol. Its IUPAC name is 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride |
| PubChem CID | 146446814 |
| Molecular Formula | C7H15ClN2O2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride |
| SMILES | CC1CN(C)CCN1C(=O)O.Cl |
| InChI | InChI=1S/C7H14N2O2.ClH/c1-6-5-8(2)3-4-9(6)7(10)11;/h6H,3-5H2,1-2H3,(H,10,11);1H |
| InChIKey | JPMRSSBTWDSBDK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride?
The IUPAC name of 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride (CID 146446814) is 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride.
What is the SMILES notation for 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride?
The canonical SMILES for 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride is CC1CN(C)CCN1C(=O)O.Cl.
What is the InChIKey of 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride?
The InChIKey is JPMRSSBTWDSBDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2.ClH/c1-6-5-8(2)3-4-9(6)7(10)11;/h6H,3-5H2,1-2H3,(H,10,11);1H.
What are the key properties of 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride?
2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride has a molecular weight of 194.66 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpiperazine-1-carboxylic acid;hydrochloride is sourced from PubChem (CID 146446814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).