About N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide
N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide (PubChem CID 146447241) has the molecular formula C12H17F3N2O2
and a molecular weight of 278.27 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide |
| PubChem CID | 146447241 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide |
| SMILES | CCN(CC1C(=O)C2CCN1CC2)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O2/c1-2-16(11(19)12(13,14)15)7-9-10(18)8-3-5-17(9)6-4-8/h8-9H,2-7H2,1H3 |
| InChIKey | MJTZGMAQDNZLHT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide?
The IUPAC name of N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide (CID 146447241) is N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide.
What is the SMILES notation for N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide?
The canonical SMILES for N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide is CCN(CC1C(=O)C2CCN1CC2)C(=O)C(F)(F)F.
What is the InChIKey of N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide?
The InChIKey is MJTZGMAQDNZLHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O2/c1-2-16(11(19)12(13,14)15)7-9-10(18)8-3-5-17(9)6-4-8/h8-9H,2-7H2,1H3.
What are the key properties of N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide?
N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide has a molecular weight of 278.27 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2,2-trifluoro-N-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]acetamide is sourced from PubChem (CID 146447241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).