C11H21N3 — CID 146447546
(1R,2S,5R)-1-azido-1,5-dimethyl-2-propan-2-ylcyclohexane (PubChem CID 146447546) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (1R,2S,5R)-1-azido-1,5-dimethyl-2-propan-2-ylcyclohexane.
| Compound Name | (1R,2S,5R)-1-azido-1,5-dimethyl-2-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 146447546 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (1R,2S,5R)-1-azido-1,5-dimethyl-2-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C11H21N3/c1-8(2)10-6-5-9(3)7-11(10,4)13-14-12/h8-10H,5-7H2,1-4H3/t9-,10+,11-/m1/s1 |
| InChIKey | HWTBKQGJKJHWDE-OUAUKWLOSA-N |
| XLogP | 4.15 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|