C10H12ClF2IN2O — CID 146447713
2-fluoro-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-4-iodopyridine;hydrochloride (PubChem CID 146447713) has the molecular formula C10H12ClF2IN2O and a molecular weight of 376.57 g/mol. Its IUPAC name is 2-fluoro-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-4-iodopyridine;hydrochloride.
| Compound Name | 2-fluoro-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-4-iodopyridine;hydrochloride |
|---|---|
| PubChem CID | 146447713 |
| Molecular Formula | C10H12ClF2IN2O |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-fluoro-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-4-iodopyridine;hydrochloride |
| SMILES | Cl.Fc1nccc(I)c1OC[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C10H11F2IN2O.ClH/c11-6-3-7(15-4-6)5-16-9-8(13)1-2-14-10(9)12;/h1-2,6-7,15H,3-5H2;1H/t6-,7-;/m0./s1 |
| InChIKey | OYXZRQKABAGADL-LEUCUCNGSA-N |
| XLogP | 2.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|