About 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine
5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 146448488) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine |
| PubChem CID | 146448488 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(CCC2CCC2)n1 |
| InChI | InChI=1S/C8H13N3O/c9-8-10-7(12-11-8)5-4-6-2-1-3-6/h6H,1-5H2,(H2,9,11) |
| InChIKey | SPYLZZPOLPUVLJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine (CID 146448488) is 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine is Nc1noc(CCC2CCC2)n1.
What is the InChIKey of 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine?
The InChIKey is SPYLZZPOLPUVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c9-8-10-7(12-11-8)5-4-6-2-1-3-6/h6H,1-5H2,(H2,9,11).
What are the key properties of 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine?
5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine has a molecular weight of 167.21 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclobutylethyl)-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 146448488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).