2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid

C6H5FN2O3S — CID 146448583

IUPAC2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid
SMILESCC(=O)Nc1nc(F)c(C(=O)O)s1
InChIInChI=1S/C6H5FN2O3S/c1-2(10)8-6-9-4(7)3(13-6)5(11)12/h1H3,(H,11,12)(H,8,9,10)
InChIKeyRKXSVOGEJWNNLH-UHFFFAOYSA-N
MW204.18 g/mol
LogP0.94
Rot. Bonds2

About 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid

2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid (PubChem CID 146448583) has the molecular formula C6H5FN2O3S and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid
PubChem CID146448583
Molecular FormulaC6H5FN2O3S
Molecular Weight204.18 g/mol
Exact Mass204.00
IUPAC Name2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid
SMILESCC(=O)Nc1nc(F)c(C(=O)O)s1
InChIInChI=1S/C6H5FN2O3S/c1-2(10)8-6-9-4(7)3(13-6)5(11)12/h1H3,(H,11,12)(H,8,9,10)
InChIKeyRKXSVOGEJWNNLH-UHFFFAOYSA-N
XLogP0.94
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.18
LogP ≤ 50.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid (CID 146448583) is 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid is CC(=O)Nc1nc(F)c(C(=O)O)s1.
What is the InChIKey of 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid?
The InChIKey is RKXSVOGEJWNNLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2O3S/c1-2(10)8-6-9-4(7)3(13-6)5(11)12/h1H3,(H,11,12)(H,8,9,10).
What are the key properties of 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid?
2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid has a molecular weight of 204.18 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-4-fluoro-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 146448583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).