C28H28F2N8O4 — CID 146448658
5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6,7-dimethoxy-N-[3-methyl-4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazolin-4-amine (PubChem CID 146448658) has the molecular formula C28H28F2N8O4 and a molecular weight of 578.58 g/mol. Its IUPAC name is 5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6,7-dimethoxy-N-[3-methyl-4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazolin-4-amine.
| Compound Name | 5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6,7-dimethoxy-N-[3-methyl-4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146448658 |
| Molecular Formula | C28H28F2N8O4 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6,7-dimethoxy-N-[3-methyl-4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Oc4cc5ncnn5cn4)c(C)c3)c2c(O[C@@H]2CCN(C)CC2(F)F)c1OC |
| InChI | InChI=1S/C28H28F2N8O4/c1-16-9-17(5-6-19(16)41-23-11-22-32-14-35-38(22)15-34-23)36-27-24-18(31-13-33-27)10-20(39-3)25(40-4)26(24)42-21-7-8-37(2)12-28(21,29)30/h5-6,9-11,13-15,21H,7-8,12H2,1-4H3,(H,31,33,36)/t21-/m1/s1 |
| InChIKey | AREPNKQIYSOBDL-OAQYLSRUSA-N |
| XLogP | 4.65 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |