About N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide
N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide (PubChem CID 146448763) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide |
| PubChem CID | 146448763 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCOc1ccc2c(c1N)C(=O)CCC2 |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)16(20)18-8-9-21-13-7-6-11-4-3-5-12(19)14(11)15(13)17/h6-7H,1,3-5,8-9,17H2,2H3,(H,18,20) |
| InChIKey | OAKMLKAYWABODE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide?
The IUPAC name of N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide (CID 146448763) is N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide.
What is the SMILES notation for N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide?
The canonical SMILES for N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide is C=C(C)C(=O)NCCOc1ccc2c(c1N)C(=O)CCC2.
What is the InChIKey of N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide?
The InChIKey is OAKMLKAYWABODE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-10(2)16(20)18-8-9-21-13-7-6-11-4-3-5-12(19)14(11)15(13)17/h6-7H,1,3-5,8-9,17H2,2H3,(H,18,20).
What are the key properties of N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide?
N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide has a molecular weight of 288.35 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1-amino-8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]ethyl]-2-methylprop-2-enamide is sourced from PubChem (CID 146448763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).