C21H15F3N6O2S — CID 146448804
2-[5-[5-cyano-6-(prop-2-enoylamino)-3-pyridinyl]-3-pyridinyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 146448804) has the molecular formula C21H15F3N6O2S and a molecular weight of 472.45 g/mol. Its IUPAC name is 2-[5-[5-cyano-6-(prop-2-enoylamino)-3-pyridinyl]-3-pyridinyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-[5-[5-cyano-6-(prop-2-enoylamino)-3-pyridinyl]-3-pyridinyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 146448804 |
| Molecular Formula | C21H15F3N6O2S |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-[5-[5-cyano-6-(prop-2-enoylamino)-3-pyridinyl]-3-pyridinyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CC(=O)Nc1ncc(-c2cncc(C(C)C(=O)Nc3ncc(C(F)(F)F)s3)c2)cc1C#N |
| InChI | InChI=1S/C21H15F3N6O2S/c1-3-17(31)29-18-12(6-25)4-15(9-27-18)14-5-13(7-26-8-14)11(2)19(32)30-20-28-10-16(33-20)21(22,23)24/h3-5,7-11H,1H2,2H3,(H,27,29,31)(H,28,30,32) |
| InChIKey | XATICCZVKDOSKC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|