C31H31BrN4O8S — CID 146449177
2-[[(3S,4R,8R,9S,10S)-9-(4-bromophenyl)-3,4-dimethoxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione (PubChem CID 146449177) has the molecular formula C31H31BrN4O8S and a molecular weight of 699.58 g/mol. Its IUPAC name is 2-[[(3S,4R,8R,9S,10S)-9-(4-bromophenyl)-3,4-dimethoxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3S,4R,8R,9S,10S)-9-(4-bromophenyl)-3,4-dimethoxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146449177 |
| Molecular Formula | C31H31BrN4O8S |
| Molecular Weight | 699.58 g/mol |
| Exact Mass | 698.10 |
| IUPAC Name | 2-[[(3S,4R,8R,9S,10S)-9-(4-bromophenyl)-3,4-dimethoxy-6-(2-nitrophenyl)sulfonyl-1,6-diazabicyclo[6.2.0]decan-10-yl]methyl]isoindole-1,3-dione |
| SMILES | CO[C@H]1CN2[C@H](CN3C(=O)c4ccccc4C3=O)[C@H](c3ccc(Br)cc3)[C@@H]2CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C[C@H]1OC |
| InChI | InChI=1S/C31H31BrN4O8S/c1-43-26-17-33(45(41,42)28-10-6-5-9-23(28)36(39)40)15-24-29(19-11-13-20(32)14-12-19)25(34(24)18-27(26)44-2)16-35-30(37)21-7-3-4-8-22(21)31(35)38/h3-14,24-27,29H,15-18H2,1-2H3/t24-,25+,26+,27-,29+/m0/s1 |
| InChIKey | JVOBLVAIGDBFHZ-RJPVIBROSA-N |
| XLogP | 3.52 |
| TPSA | 139.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|