C17H22FN7O4S — CID 146449332
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[[(2S)-4-(methylsulfonimidoyl)morpholin-2-yl]methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 146449332) has the molecular formula C17H22FN7O4S and a molecular weight of 439.47 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[[(2S)-4-(methylsulfonimidoyl)morpholin-2-yl]methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[[(2S)-4-(methylsulfonimidoyl)morpholin-2-yl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 146449332 |
| Molecular Formula | C17H22FN7O4S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[[(2S)-4-(methylsulfonimidoyl)morpholin-2-yl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)N1CCO[C@@H](CNc2nonc2/C(=N/[C@H]2Cc3ccc(F)cc32)NO)C1 |
| InChI | InChI=1S/C17H22FN7O4S/c1-30(19,27)25-4-5-28-12(9-25)8-20-16-15(23-29-24-16)17(22-26)21-14-6-10-2-3-11(18)7-13(10)14/h2-3,7,12,14,19,26H,4-6,8-9H2,1H3,(H,20,24)(H,21,22)/t12-,14-,30?/m0/s1 |
| InChIKey | DYKKUOXNCUWMCT-LKRLTSRTSA-N |
| XLogP | 0.94 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|