C23H28N6O3 — CID 146449534
2-[(2S)-2-[3-(2-methoxyquinolin-3-yl)-1H-1,2,4-triazol-5-yl]-4-(oxolan-3-ylmethyl)piperazin-1-yl]acetaldehyde (PubChem CID 146449534) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-[(2S)-2-[3-(2-methoxyquinolin-3-yl)-1H-1,2,4-triazol-5-yl]-4-(oxolan-3-ylmethyl)piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[(2S)-2-[3-(2-methoxyquinolin-3-yl)-1H-1,2,4-triazol-5-yl]-4-(oxolan-3-ylmethyl)piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 146449534 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[(2S)-2-[3-(2-methoxyquinolin-3-yl)-1H-1,2,4-triazol-5-yl]-4-(oxolan-3-ylmethyl)piperazin-1-yl]acetaldehyde |
| SMILES | COc1nc2ccccc2cc1-c1n[nH]c([C@@H]2CN(CC3CCOC3)CCN2CC=O)n1 |
| InChI | InChI=1S/C23H28N6O3/c1-31-23-18(12-17-4-2-3-5-19(17)24-23)21-25-22(27-26-21)20-14-28(7-8-29(20)9-10-30)13-16-6-11-32-15-16/h2-5,10,12,16,20H,6-9,11,13-15H2,1H3,(H,25,26,27)/t16?,20-/m0/s1 |
| InChIKey | HGXMXVUZGSZSQX-FZCLLLDFSA-N |
| XLogP | 1.92 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|