C28H33FN4O4 — CID 146449903
5-[2-[(2-carbamoyl-2-adamantyl)amino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 146449903) has the molecular formula C28H33FN4O4 and a molecular weight of 508.59 g/mol. Its IUPAC name is 5-[2-[(2-carbamoyl-2-adamantyl)amino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-[(2-carbamoyl-2-adamantyl)amino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146449903 |
| Molecular Formula | C28H33FN4O4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 5-[2-[(2-carbamoyl-2-adamantyl)amino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(=O)C(=O)NC3(C(N)=O)C4CC5CC(C4)CC3C5)n(C)c2C)ccc1F |
| InChI | InChI=1S/C28H33FN4O4/c1-13-7-20(5-6-21(13)29)31-25(35)22-14(2)23(33(4)15(22)3)24(34)26(36)32-28(27(30)37)18-9-16-8-17(11-18)12-19(28)10-16/h5-7,16-19H,8-12H2,1-4H3,(H2,30,37)(H,31,35)(H,32,36) |
| InChIKey | YTUBZPWOEGBZBV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|