C23H23F2N5O4 — CID 146450008
N-(3,4-difluorophenyl)-2-methyl-3-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 146450008) has the molecular formula C23H23F2N5O4 and a molecular weight of 471.46 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-methyl-3-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-methyl-3-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 146450008 |
| Molecular Formula | C23H23F2N5O4 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-methyl-3-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | Cc1noc(C(C)NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(F)c(F)c3)c3n2CCCC3)n1 |
| InChI | InChI=1S/C23H23F2N5O4/c1-11-18(21(32)28-14-7-8-15(24)16(25)10-14)17-6-4-5-9-30(17)19(11)20(31)22(33)26-12(2)23-27-13(3)29-34-23/h7-8,10,12H,4-6,9H2,1-3H3,(H,26,33)(H,28,32) |
| InChIKey | UCPOUHHTSRUQFK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|