C22H23F4N3O3 — CID 146450285
N-(4-fluoro-3-methylphenyl)-2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 146450285) has the molecular formula C22H23F4N3O3 and a molecular weight of 453.44 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 146450285 |
| Molecular Formula | C22H23F4N3O3 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(=O)C(=O)NC(C)C(F)(F)F)n3c2CCCC3)ccc1F |
| InChI | InChI=1S/C22H23F4N3O3/c1-11-10-14(7-8-15(11)23)28-20(31)17-12(2)18(29-9-5-4-6-16(17)29)19(30)21(32)27-13(3)22(24,25)26/h7-8,10,13H,4-6,9H2,1-3H3,(H,27,32)(H,28,31) |
| InChIKey | KPEPEISVOAMWKX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|