C27H33FN6O4 — CID 146450320
3-[2-[2-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]propan-2-ylamino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 146450320) has the molecular formula C27H33FN6O4 and a molecular weight of 524.60 g/mol. Its IUPAC name is 3-[2-[2-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]propan-2-ylamino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | 3-[2-[2-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]propan-2-ylamino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 146450320 |
| Molecular Formula | C27H33FN6O4 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[2-[2-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]propan-2-ylamino]-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(=O)C(=O)NC(C)(C)c3nc(CN(C)C)no3)n3c2CCCC3)ccc1F |
| InChI | InChI=1S/C27H33FN6O4/c1-15-13-17(10-11-18(15)28)29-24(36)21-16(2)22(34-12-8-7-9-19(21)34)23(35)25(37)31-27(3,4)26-30-20(32-38-26)14-33(5)6/h10-11,13H,7-9,12,14H2,1-6H3,(H,29,36)(H,31,37) |
| InChIKey | QZATYDATKGDNAJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 122.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|