About [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid
[chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid (PubChem CID 146450734) has the molecular formula C8H11ClN2O4S2
and a molecular weight of 298.77 g/mol. Its IUPAC name is [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid.
Molecular Properties
| Compound Name | [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid |
| PubChem CID | 146450734 |
| Molecular Formula | C8H11ClN2O4S2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid |
| SMILES | COC(C)(C)c1ncc(S(=O)(Cl)=NC(=O)O)s1 |
| InChI | InChI=1S/C8H11ClN2O4S2/c1-8(2,15-3)6-10-4-5(16-6)17(9,14)11-7(12)13/h4H,1-3H3,(H,12,13) |
| InChIKey | KDQUYRKJIOAFIE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid?
The IUPAC name of [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid (CID 146450734) is [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid.
What is the SMILES notation for [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid?
The canonical SMILES for [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid is COC(C)(C)c1ncc(S(=O)(Cl)=NC(=O)O)s1.
What is the InChIKey of [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid?
The InChIKey is KDQUYRKJIOAFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O4S2/c1-8(2,15-3)6-10-4-5(16-6)17(9,14)11-7(12)13/h4H,1-3H3,(H,12,13).
What are the key properties of [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid?
[chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid has a molecular weight of 298.77 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro-[2-(2-methoxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamic acid is sourced from PubChem (CID 146450734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).