C10H12F3N3O3 — CID 146450852
2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid (PubChem CID 146450852) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid.
| Compound Name | 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 146450852 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid |
| SMILES | O=C(O)c1cc2n(n1)CC(CCNCC(F)(F)F)O2 |
| InChI | InChI=1S/C10H12F3N3O3/c11-10(12,13)5-14-2-1-6-4-16-8(19-6)3-7(15-16)9(17)18/h3,6,14H,1-2,4-5H2,(H,17,18) |
| InChIKey | DKTTYPBJYPKVEE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|