C18H17ClF2N4O5S — CID 146451125
N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-[(4-methoxyphenyl)methyl]methanesulfonamide (PubChem CID 146451125) has the molecular formula C18H17ClF2N4O5S and a molecular weight of 474.87 g/mol. Its IUPAC name is N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-[(4-methoxyphenyl)methyl]methanesulfonamide.
| Compound Name | N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-[(4-methoxyphenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 146451125 |
| Molecular Formula | C18H17ClF2N4O5S |
| Molecular Weight | 474.87 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-[(4-methoxyphenyl)methyl]methanesulfonamide |
| SMILES | COc1ccc(CN(c2nn(CC(F)F)c3c([N+](=O)[O-])ccc(Cl)c23)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H17ClF2N4O5S/c1-30-12-5-3-11(4-6-12)9-24(31(2,28)29)18-16-13(19)7-8-14(25(26)27)17(16)23(22-18)10-15(20)21/h3-8,15H,9-10H2,1-2H3 |
| InChIKey | PCMKRLYEGGMIMY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|