About N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide
N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 146451157) has the molecular formula C11H11ClF2N4O6S2
and a molecular weight of 432.81 g/mol. Its IUPAC name is N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide |
| PubChem CID | 146451157 |
| Molecular Formula | C11H11ClF2N4O6S2 |
| Molecular Weight | 432.81 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1nn(CC(F)F)c2c([N+](=O)[O-])ccc(Cl)c12)S(C)(=O)=O |
| InChI | InChI=1S/C11H11ClF2N4O6S2/c1-25(21,22)18(26(2,23)24)11-9-6(12)3-4-7(17(19)20)10(9)16(15-11)5-8(13)14/h3-4,8H,5H2,1-2H3 |
| InChIKey | UXLFQONUWBTLSQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.81 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide?
The IUPAC name of N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide (CID 146451157) is N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide.
What is the SMILES notation for N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide?
The canonical SMILES for N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide is CS(=O)(=O)N(c1nn(CC(F)F)c2c([N+](=O)[O-])ccc(Cl)c12)S(C)(=O)=O.
What is the InChIKey of N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide?
The InChIKey is UXLFQONUWBTLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2N4O6S2/c1-25(21,22)18(26(2,23)24)11-9-6(12)3-4-7(17(19)20)10(9)16(15-11)5-8(13)14/h3-4,8H,5H2,1-2H3.
What are the key properties of N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide?
N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide has a molecular weight of 432.81 g/mol, XLogP of 1.59, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-chloro-1-(2,2-difluoroethyl)-7-nitroindazol-3-yl]-N-methylsulfonylmethanesulfonamide is sourced from PubChem (CID 146451157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).