About 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid
2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid (PubChem CID 146451529) has the molecular formula C9H11F2NO4
and a molecular weight of 235.19 g/mol. Its IUPAC name is 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid |
| PubChem CID | 146451529 |
| Molecular Formula | C9H11F2NO4 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)O)CC2(C1)CC2(F)F |
| InChI | InChI=1S/C9H11F2NO4/c10-9(11)3-8(9)1-5(6(13)14)2-12(4-8)7(15)16/h5H,1-4H2,(H,13,14)(H,15,16) |
| InChIKey | PUMVEBGXMNEFBV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid?
The IUPAC name of 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid (CID 146451529) is 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid.
What is the SMILES notation for 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid?
The canonical SMILES for 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid is O=C(O)C1CN(C(=O)O)CC2(C1)CC2(F)F.
What is the InChIKey of 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid?
The InChIKey is PUMVEBGXMNEFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO4/c10-9(11)3-8(9)1-5(6(13)14)2-12(4-8)7(15)16/h5H,1-4H2,(H,13,14)(H,15,16).
What are the key properties of 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid?
2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid has a molecular weight of 235.19 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5-azaspiro[2.5]octane-5,7-dicarboxylic acid is sourced from PubChem (CID 146451529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).