About (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate
(3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 146451636) has the molecular formula C20H26O4
and a molecular weight of 330.42 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate.
Molecular Properties
| Compound Name | (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate |
| PubChem CID | 146451636 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Oc1cccc(C(=O)OC2CC(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C20H26O4/c1-13(2)18(21)23-16-8-6-7-15(10-16)19(22)24-17-9-14(3)11-20(4,5)12-17/h6-8,10,14,17H,1,9,11-12H2,2-5H3 |
| InChIKey | SBGBEMODHLLOSC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate?
The IUPAC name of (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate (CID 146451636) is (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate.
What is the SMILES notation for (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate?
The canonical SMILES for (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate is C=C(C)C(=O)Oc1cccc(C(=O)OC2CC(C)CC(C)(C)C2)c1.
What is the InChIKey of (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate?
The InChIKey is SBGBEMODHLLOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O4/c1-13(2)18(21)23-16-8-6-7-15(10-16)19(22)24-17-9-14(3)11-20(4,5)12-17/h6-8,10,14,17H,1,9,11-12H2,2-5H3.
What are the key properties of (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate?
(3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate has a molecular weight of 330.42 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3,5-trimethylcyclohexyl) 3-(2-methylprop-2-enoyloxy)benzoate is sourced from PubChem (CID 146451636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).