C44H35ClN2O5 — CID 146452312
(E)-4-[[1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(2-methoxycarbonylphenyl)propyl]amino]-4-oxo-2,3-diphenylbut-2-enoic acid (PubChem CID 146452312) has the molecular formula C44H35ClN2O5 and a molecular weight of 707.23 g/mol. Its IUPAC name is (E)-4-[[1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(2-methoxycarbonylphenyl)propyl]amino]-4-oxo-2,3-diphenylbut-2-enoic acid.
| Compound Name | (E)-4-[[1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(2-methoxycarbonylphenyl)propyl]amino]-4-oxo-2,3-diphenylbut-2-enoic acid |
|---|---|
| PubChem CID | 146452312 |
| Molecular Formula | C44H35ClN2O5 |
| Molecular Weight | 707.23 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | (E)-4-[[1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(2-methoxycarbonylphenyl)propyl]amino]-4-oxo-2,3-diphenylbut-2-enoic acid |
| SMILES | COC(=O)c1ccccc1CCC(NC(=O)/C(=C(/C(=O)O)c1ccccc1)c1ccccc1)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C44H35ClN2O5/c1-52-44(51)37-18-9-8-12-30(37)22-26-38(34-17-10-11-29(27-34)19-24-36-25-21-31-20-23-35(45)28-39(31)46-36)47-42(48)40(32-13-4-2-5-14-32)41(43(49)50)33-15-6-3-7-16-33/h2-21,23-25,27-28,38H,22,26H2,1H3,(H,47,48)(H,49,50)/b24-19+,41-40+ |
| InChIKey | IYVUFYAITMZJJF-RKFDIFNBSA-N |
| XLogP | 9.33 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.23 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|