C28H31N5O4S — CID 146452346
tert-butyl 2-[2-[[4-[2-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]-methylcarbamoyl]-1,3-dihydroinden-2-yl]acetate (PubChem CID 146452346) has the molecular formula C28H31N5O4S and a molecular weight of 533.65 g/mol. Its IUPAC name is tert-butyl 2-[2-[[4-[2-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]-methylcarbamoyl]-1,3-dihydroinden-2-yl]acetate.
| Compound Name | tert-butyl 2-[2-[[4-[2-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]-methylcarbamoyl]-1,3-dihydroinden-2-yl]acetate |
|---|---|
| PubChem CID | 146452346 |
| Molecular Formula | C28H31N5O4S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | tert-butyl 2-[2-[[4-[2-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]-methylcarbamoyl]-1,3-dihydroinden-2-yl]acetate |
| SMILES | CN(C(=O)C1(CC(=O)OC(C)(C)C)Cc2ccccc2C1)c1nc(-c2ccccc2OCCN=[N+]=[N-])cs1 |
| InChI | InChI=1S/C28H31N5O4S/c1-27(2,3)37-24(34)17-28(15-19-9-5-6-10-20(19)16-28)25(35)33(4)26-31-22(18-38-26)21-11-7-8-12-23(21)36-14-13-30-32-29/h5-12,18H,13-17H2,1-4H3 |
| InChIKey | FRTTWCFUUPYLQT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 117.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|