About 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine
4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine (PubChem CID 146452707) has the molecular formula C11H20F2N2O
and a molecular weight of 234.29 g/mol. Its IUPAC name is 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine.
Molecular Properties
| Compound Name | 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine |
| PubChem CID | 146452707 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine |
| SMILES | FC1(F)CCN(CCOC2CCNCC2)C1 |
| InChI | InChI=1S/C11H20F2N2O/c12-11(13)3-6-15(9-11)7-8-16-10-1-4-14-5-2-10/h10,14H,1-9H2 |
| InChIKey | FNZMTUDRKKSJRW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine?
The IUPAC name of 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine (CID 146452707) is 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine.
What is the SMILES notation for 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine?
The canonical SMILES for 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine is FC1(F)CCN(CCOC2CCNCC2)C1.
What is the InChIKey of 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine?
The InChIKey is FNZMTUDRKKSJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O/c12-11(13)3-6-15(9-11)7-8-16-10-1-4-14-5-2-10/h10,14H,1-9H2.
What are the key properties of 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine?
4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine has a molecular weight of 234.29 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]piperidine is sourced from PubChem (CID 146452707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).