About methanediimine;1-methylidenefluorene
methanediimine;1-methylidenefluorene (PubChem CID 146453821) has the molecular formula C15H12N2
and a molecular weight of 220.27 g/mol. Its IUPAC name is methanediimine;1-methylidenefluorene.
Molecular Properties
| Compound Name | methanediimine;1-methylidenefluorene |
| PubChem CID | 146453821 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | methanediimine;1-methylidenefluorene |
| SMILES | C=c1cccc2c1=Cc1ccccc1-2.N=C=N |
| InChI | InChI=1S/C14H10.CH2N2/c1-10-5-4-8-13-12-7-3-2-6-11(12)9-14(10)13;2-1-3/h2-9H,1H2;2-3H |
| InChIKey | PNSWZXNFAOVPNJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methanediimine;1-methylidenefluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanediimine;1-methylidenefluorene?
The IUPAC name of methanediimine;1-methylidenefluorene (CID 146453821) is methanediimine;1-methylidenefluorene.
What is the SMILES notation for methanediimine;1-methylidenefluorene?
The canonical SMILES for methanediimine;1-methylidenefluorene is C=c1cccc2c1=Cc1ccccc1-2.N=C=N.
What is the InChIKey of methanediimine;1-methylidenefluorene?
The InChIKey is PNSWZXNFAOVPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.CH2N2/c1-10-5-4-8-13-12-7-3-2-6-11(12)9-14(10)13;2-1-3/h2-9H,1H2;2-3H.
What are the key properties of methanediimine;1-methylidenefluorene?
methanediimine;1-methylidenefluorene has a molecular weight of 220.27 g/mol, XLogP of 2.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanediimine;1-methylidenefluorene is sourced from PubChem (CID 146453821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).