About (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine
(2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine (PubChem CID 146453833) has the molecular formula C16H21FN2O2
and a molecular weight of 292.35 g/mol. Its IUPAC name is (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine.
Molecular Properties
| Compound Name | (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine |
| PubChem CID | 146453833 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine |
| SMILES | CCCCc1nc2ccc(OCC/C(=C/F)CN)cc2o1 |
| InChI | InChI=1S/C16H21FN2O2/c1-2-3-4-16-19-14-6-5-13(9-15(14)21-16)20-8-7-12(10-17)11-18/h5-6,9-10H,2-4,7-8,11,18H2,1H3/b12-10- |
| InChIKey | NGSZUMUEIFMWBP-BENRWUELSA-N |
| XLogP | 3.75 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine?
The IUPAC name of (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine (CID 146453833) is (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine.
What is the SMILES notation for (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine?
The canonical SMILES for (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine is CCCCc1nc2ccc(OCC/C(=C/F)CN)cc2o1.
What is the InChIKey of (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine?
The InChIKey is NGSZUMUEIFMWBP-BENRWUELSA-N. The full InChI is InChI=1S/C16H21FN2O2/c1-2-3-4-16-19-14-6-5-13(9-15(14)21-16)20-8-7-12(10-17)11-18/h5-6,9-10H,2-4,7-8,11,18H2,1H3/b12-10-.
What are the key properties of (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine?
(2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine has a molecular weight of 292.35 g/mol, XLogP of 3.75, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4-[(2-butyl-1,3-benzoxazol-6-yl)oxy]-2-(fluoromethylidene)butan-1-amine is sourced from PubChem (CID 146453833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).