C25H31FN2O5S — CID 146453846
[(E)-1-amino-2-[[2-(4,4-dimethylpentyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate (PubChem CID 146453846) has the molecular formula C25H31FN2O5S and a molecular weight of 490.60 g/mol. Its IUPAC name is [(E)-1-amino-2-[[2-(4,4-dimethylpentyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-1-amino-2-[[2-(4,4-dimethylpentyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146453846 |
| Molecular Formula | C25H31FN2O5S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | [(E)-1-amino-2-[[2-(4,4-dimethylpentyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(N)/C(=C/F)COc2ccc3nc(CCCC(C)(C)C)oc3c2)cc1 |
| InChI | InChI=1S/C25H31FN2O5S/c1-17-7-10-20(11-8-17)34(29,30)33-24(27)18(15-26)16-31-19-9-12-21-22(14-19)32-23(28-21)6-5-13-25(2,3)4/h7-12,14-15,24H,5-6,13,16,27H2,1-4H3/b18-15+ |
| InChIKey | QOSYFSCXDJSOLP-OBGWFSINSA-N |
| XLogP | 5.43 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|