C26H31FN2O5S — CID 146453853
[(E)-1-amino-2-[[2-(4,4-dimethylcyclohexyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate (PubChem CID 146453853) has the molecular formula C26H31FN2O5S and a molecular weight of 502.61 g/mol. Its IUPAC name is [(E)-1-amino-2-[[2-(4,4-dimethylcyclohexyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-1-amino-2-[[2-(4,4-dimethylcyclohexyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146453853 |
| Molecular Formula | C26H31FN2O5S |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [(E)-1-amino-2-[[2-(4,4-dimethylcyclohexyl)-1,3-benzoxazol-6-yl]oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(N)/C(=C/F)COc2ccc3nc(C4CCC(C)(C)CC4)oc3c2)cc1 |
| InChI | InChI=1S/C26H31FN2O5S/c1-17-4-7-21(8-5-17)35(30,31)34-24(28)19(15-27)16-32-20-6-9-22-23(14-20)33-25(29-22)18-10-12-26(2,3)13-11-18/h4-9,14-15,18,24H,10-13,16,28H2,1-3H3/b19-15+ |
| InChIKey | BSNRLPXMNZUMHX-XDJHFCHBSA-N |
| XLogP | 5.74 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|